About butane-1-thiolate;tributylstannanylium
butane-1-thiolate;tributylstannanylium (PubChem CID 6102132) has the molecular formula C16H36SSn
and a molecular weight of 379.24 g/mol. Its IUPAC name is butane-1-thiolate;tributylstannanylium.
Molecular Properties
| Compound Name | butane-1-thiolate;tributylstannanylium |
| PubChem CID | 6102132 |
| Molecular Formula | C16H36SSn |
| Molecular Weight | 379.24 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | butane-1-thiolate;tributylstannanylium |
| SMILES | CCCC[S-].CCCC[Sn+](CCCC)CCCC |
| InChI | InChI=1S/C4H10S.3C4H9.Sn/c1-2-3-4-5;3*1-3-4-2;/h5H,2-4H2,1H3;3*1,3-4H2,2H3;/q;;;;+1/p-1 |
| InChIKey | QYXUTCIFPBUUFA-UHFFFAOYSA-M |
| XLogP | 6.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.24 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze butane-1-thiolate;tributylstannanylium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane-1-thiolate;tributylstannanylium?
The IUPAC name of butane-1-thiolate;tributylstannanylium (CID 6102132) is butane-1-thiolate;tributylstannanylium.
What is the SMILES notation for butane-1-thiolate;tributylstannanylium?
The canonical SMILES for butane-1-thiolate;tributylstannanylium is CCCC[S-].CCCC[Sn+](CCCC)CCCC.
What is the InChIKey of butane-1-thiolate;tributylstannanylium?
The InChIKey is QYXUTCIFPBUUFA-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H10S.3C4H9.Sn/c1-2-3-4-5;3*1-3-4-2;/h5H,2-4H2,1H3;3*1,3-4H2,2H3;/q;;;;+1/p-1.
What are the key properties of butane-1-thiolate;tributylstannanylium?
butane-1-thiolate;tributylstannanylium has a molecular weight of 379.24 g/mol, XLogP of 6.21, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butane-1-thiolate;tributylstannanylium is sourced from PubChem (CID 6102132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).