C5H10N2O3 — CID 7021858
2-[[2-(methylazaniumyl)acetyl]amino]acetate (PubChem CID 7021858) has the molecular formula C5H10N2O3 and a molecular weight of 146.15 g/mol. Its IUPAC name is 2-[[2-(methylazaniumyl)acetyl]amino]acetate.
| Compound Name | 2-[[2-(methylazaniumyl)acetyl]amino]acetate |
|---|---|
| PubChem CID | 7021858 |
| Molecular Formula | C5H10N2O3 |
| Molecular Weight | 146.15 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | 2-[[2-(methylazaniumyl)acetyl]amino]acetate |
| SMILES | C[NH2+]CC(=O)NCC(=O)[O-] |
| InChI | InChI=1S/C5H10N2O3/c1-6-2-4(8)7-3-5(9)10/h6H,2-3H2,1H3,(H,7,8)(H,9,10) |
| InChIKey | XBSXVUHHZXULRO-UHFFFAOYSA-N |
| XLogP | -3.95 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.15 |
| LogP ≤ 5 | -3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |