C11H25N3O3S+2 — CID 59502438
[(2S)-6-azaniumyl-1-[[(1R)-1-carboxy-3-methylsulfanylpropyl]amino]-1-oxohexan-2-yl]azanium (PubChem CID 59502438) has the molecular formula C11H25N3O3S+2 and a molecular weight of 279.41 g/mol. Its IUPAC name is [(2S)-6-azaniumyl-1-[[(1R)-1-carboxy-3-methylsulfanylpropyl]amino]-1-oxohexan-2-yl]azanium.
| Compound Name | [(2S)-6-azaniumyl-1-[[(1R)-1-carboxy-3-methylsulfanylpropyl]amino]-1-oxohexan-2-yl]azanium |
|---|---|
| PubChem CID | 59502438 |
| Molecular Formula | C11H25N3O3S+2 |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | [(2S)-6-azaniumyl-1-[[(1R)-1-carboxy-3-methylsulfanylpropyl]amino]-1-oxohexan-2-yl]azanium |
| SMILES | CSCC[C@@H](NC(=O)[C@@H]([NH3+])CCCC[NH3+])C(=O)O |
| InChI | InChI=1S/C11H23N3O3S/c1-18-7-5-9(11(16)17)14-10(15)8(13)4-2-3-6-12/h8-9H,2-7,12-13H2,1H3,(H,14,15)(H,16,17)/p+2/t8-,9+/m0/s1 |
| InChIKey | XBZOQGHZGQLEQO-DTWKUNHWSA-P |
| XLogP | -1.67 |
| TPSA | 121.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|