C22H37N5O6 — CID 164671310
(2S)-2-[[2-[[(2S)-2-azaniumyl-6-(2-methylprop-2-enoylamino)hexanoyl]amino]acetyl]amino]-6-(2-methylprop-2-enoylamino)hexanoate (PubChem CID 164671310) has the molecular formula C22H37N5O6 and a molecular weight of 467.57 g/mol. Its IUPAC name is (2S)-2-[[2-[[(2S)-2-azaniumyl-6-(2-methylprop-2-enoylamino)hexanoyl]amino]acetyl]amino]-6-(2-methylprop-2-enoylamino)hexanoate.
| Compound Name | (2S)-2-[[2-[[(2S)-2-azaniumyl-6-(2-methylprop-2-enoylamino)hexanoyl]amino]acetyl]amino]-6-(2-methylprop-2-enoylamino)hexanoate |
|---|---|
| PubChem CID | 164671310 |
| Molecular Formula | C22H37N5O6 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.27 |
| IUPAC Name | (2S)-2-[[2-[[(2S)-2-azaniumyl-6-(2-methylprop-2-enoylamino)hexanoyl]amino]acetyl]amino]-6-(2-methylprop-2-enoylamino)hexanoate |
| SMILES | C=C(C)C(=O)NCCCC[C@H](NC(=O)CNC(=O)[C@@H]([NH3+])CCCCNC(=O)C(=C)C)C(=O)[O-] |
| InChI | InChI=1S/C22H37N5O6/c1-14(2)19(29)24-11-7-5-9-16(23)21(31)26-13-18(28)27-17(22(32)33)10-6-8-12-25-20(30)15(3)4/h16-17H,1,3,5-13,23H2,2,4H3,(H,24,29)(H,25,30)(H,26,31)(H,27,28)(H,32,33)/t16-,17-/m0/s1 |
| InChIKey | YHZKHQWSPXREGG-IRXDYDNUSA-N |
| XLogP | -2.33 |
| TPSA | 184.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|