C6H15N2O2+ — CID 5242389
2,6-bis(azaniumyl)hexanoate (PubChem CID 5242389) has the molecular formula C6H15N2O2+ and a molecular weight of 147.20 g/mol. Its IUPAC name is 2,6-bis(azaniumyl)hexanoate.
| Compound Name | 2,6-bis(azaniumyl)hexanoate |
|---|---|
| PubChem CID | 5242389 |
| Molecular Formula | C6H15N2O2+ |
| Molecular Weight | 147.20 g/mol |
| Exact Mass | 147.11 |
| IUPAC Name | 2,6-bis(azaniumyl)hexanoate |
| SMILES | [NH3+]CCCCC([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C6H14N2O2/c7-4-2-1-3-5(8)6(9)10/h5H,1-4,7-8H2,(H,9,10)/p+1 |
| InChIKey | KDXKERNSBIXSRK-UHFFFAOYSA-O |
| XLogP | -3.24 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.20 |
| LogP ≤ 5 | -3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|