C6H14FN2O2+ — CID 7019593
(2S,5S)-2,6-bis(azaniumyl)-5-fluorohexanoate (PubChem CID 7019593) has the molecular formula C6H14FN2O2+ and a molecular weight of 165.19 g/mol. Its IUPAC name is (2S,5S)-2,6-bis(azaniumyl)-5-fluorohexanoate.
| Compound Name | (2S,5S)-2,6-bis(azaniumyl)-5-fluorohexanoate |
|---|---|
| PubChem CID | 7019593 |
| Molecular Formula | C6H14FN2O2+ |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | (2S,5S)-2,6-bis(azaniumyl)-5-fluorohexanoate |
| SMILES | [NH3+]C[C@@H](F)CC[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C6H13FN2O2/c7-4(3-8)1-2-5(9)6(10)11/h4-5H,1-3,8-9H2,(H,10,11)/p+1/t4-,5-/m0/s1 |
| InChIKey | HILHCIBEZCWKBD-WHFBIAKZSA-O |
| XLogP | -3.29 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | -3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |