C6H15ClN2O3 — CID 139063890
(2S,5R)-2,6-bis(azaniumyl)-5-hydroxyhexanoate chloride (PubChem CID 139063890) has the molecular formula C6H15ClN2O3 and a molecular weight of 198.65 g/mol. Its IUPAC name is (2S,5R)-2,6-bis(azaniumyl)-5-hydroxyhexanoate chloride.
| Compound Name | (2S,5R)-2,6-bis(azaniumyl)-5-hydroxyhexanoate chloride |
|---|---|
| PubChem CID | 139063890 |
| Molecular Formula | C6H15ClN2O3 |
| Molecular Weight | 198.65 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | (2S,5R)-2,6-bis(azaniumyl)-5-hydroxyhexanoate chloride |
| SMILES | [Cl-].[NH3+]C[C@H](O)CC[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C6H14N2O3.ClH/c7-3-4(9)1-2-5(8)6(10)11;/h4-5,9H,1-3,7-8H2,(H,10,11);1H/t4-,5+;/m1./s1 |
| InChIKey | MJXVOTKVFFAZQJ-JBUOLDKXSA-N |
| XLogP | -7.27 |
| TPSA | 115.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.65 |
| LogP ≤ 5 | -7.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |