C6H10NO5- — CID 102515406
(4S)-4-azaniumyl-2-hydroxy-2-methylpentanedioate (PubChem CID 102515406) has the molecular formula C6H10NO5- and a molecular weight of 176.15 g/mol. Its IUPAC name is (4S)-4-azaniumyl-2-hydroxy-2-methylpentanedioate.
| Compound Name | (4S)-4-azaniumyl-2-hydroxy-2-methylpentanedioate |
|---|---|
| PubChem CID | 102515406 |
| Molecular Formula | C6H10NO5- |
| Molecular Weight | 176.15 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | (4S)-4-azaniumyl-2-hydroxy-2-methylpentanedioate |
| SMILES | CC(O)(C[C@H]([NH3+])C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C6H11NO5/c1-6(12,5(10)11)2-3(7)4(8)9/h3,12H,2,7H2,1H3,(H,8,9)(H,10,11)/p-1/t3-,6?/m0/s1 |
| InChIKey | ONTAOGAXMOTXQW-FWRGRRDFSA-M |
| XLogP | -4.76 |
| TPSA | 128.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.15 |
| LogP ≤ 5 | -4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |