C6H13Cl2NO2 — CID 517027
2,2-dichloropropanoate;propan-2-ylazanium (PubChem CID 517027) has the molecular formula C6H13Cl2NO2 and a molecular weight of 202.08 g/mol. Its IUPAC name is 2,2-dichloropropanoate;propan-2-ylazanium.
| Compound Name | 2,2-dichloropropanoate;propan-2-ylazanium |
|---|---|
| PubChem CID | 517027 |
| Molecular Formula | C6H13Cl2NO2 |
| Molecular Weight | 202.08 g/mol |
| Exact Mass | 201.03 |
| IUPAC Name | 2,2-dichloropropanoate;propan-2-ylazanium |
| SMILES | CC(C)[NH3+].CC(Cl)(Cl)C(=O)[O-] |
| InChI | InChI=1S/C3H4Cl2O2.C3H9N/c1-3(4,5)2(6)7;1-3(2)4/h1H3,(H,6,7);3H,4H2,1-2H3 |
| InChIKey | AIKRBIXAWGYDJG-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.08 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|