C6H14N3O3+ — CID 140748256
2-azaniumyl-5-(azaniumylcarbonylamino)pentanoate (PubChem CID 140748256) has the molecular formula C6H14N3O3+ and a molecular weight of 176.20 g/mol. Its IUPAC name is 2-azaniumyl-5-(azaniumylcarbonylamino)pentanoate.
| Compound Name | 2-azaniumyl-5-(azaniumylcarbonylamino)pentanoate |
|---|---|
| PubChem CID | 140748256 |
| Molecular Formula | C6H14N3O3+ |
| Molecular Weight | 176.20 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | 2-azaniumyl-5-(azaniumylcarbonylamino)pentanoate |
| SMILES | [NH3+]C(=O)NCCCC([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C6H13N3O3/c7-4(5(10)11)2-1-3-9-6(8)12/h4H,1-3,7H2,(H,10,11)(H3,8,9,12)/p+1 |
| InChIKey | RHGKLRLOHDJJDR-UHFFFAOYSA-O |
| XLogP | -3.92 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.20 |
| LogP ≤ 5 | -3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|