C6H14N5O4+ — CID 6999895
(2R)-5-[amino(nitramido)methylidene]azaniumyl-2-azaniumylpentanoate (PubChem CID 6999895) has the molecular formula C6H14N5O4+ and a molecular weight of 220.21 g/mol. Its IUPAC name is (2R)-5-[amino(nitramido)methylidene]azaniumyl-2-azaniumylpentanoate.
| Compound Name | (2R)-5-[amino(nitramido)methylidene]azaniumyl-2-azaniumylpentanoate |
|---|---|
| PubChem CID | 6999895 |
| Molecular Formula | C6H14N5O4+ |
| Molecular Weight | 220.21 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | (2R)-5-[amino(nitramido)methylidene]azaniumyl-2-azaniumylpentanoate |
| SMILES | N/C(N[N+](=O)[O-])=[NH+]\CCC[C@@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C6H13N5O4/c7-4(5(12)13)2-1-3-9-6(8)10-11(14)15/h4H,1-3,7H2,(H,12,13)(H3,8,9,10)/p+1/t4-/m1/s1 |
| InChIKey | MRAUNPAHJZDYCK-SCSAIBSYSA-O |
| XLogP | -5.70 |
| TPSA | 162.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.21 |
| LogP ≤ 5 | -5.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|