C6H16N6O8 — CID 139064900
[(4S)-4-azaniumyl-4-carboxybutyl]-(diaminomethylidene)azanium dinitrate (PubChem CID 139064900) has the molecular formula C6H16N6O8 and a molecular weight of 300.23 g/mol. Its IUPAC name is [(4S)-4-azaniumyl-4-carboxybutyl]-(diaminomethylidene)azanium dinitrate.
| Compound Name | [(4S)-4-azaniumyl-4-carboxybutyl]-(diaminomethylidene)azanium dinitrate |
|---|---|
| PubChem CID | 139064900 |
| Molecular Formula | C6H16N6O8 |
| Molecular Weight | 300.23 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | [(4S)-4-azaniumyl-4-carboxybutyl]-(diaminomethylidene)azanium dinitrate |
| SMILES | NC(N)=[NH+]CCC[C@H]([NH3+])C(=O)O.O=[N+]([O-])[O-].O=[N+]([O-])[O-] |
| InChI | InChI=1S/C6H14N4O2.2NO3/c7-4(5(11)12)2-1-3-10-6(8)9;2*2-1(3)4/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);;/q;2*-1/p+2/t4-;;/m0../s1 |
| InChIKey | NMLOJLQASKNFPB-FHNDMYTFSA-P |
| XLogP | -4.66 |
| TPSA | 263.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.23 |
| LogP ≤ 5 | -4.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|