C8H19N4O2+ — CID 102255099
[(4S)-4-carboxy-4-(dimethylamino)butyl]-(diaminomethylidene)azanium (PubChem CID 102255099) has the molecular formula C8H19N4O2+ and a molecular weight of 203.27 g/mol. Its IUPAC name is [(4S)-4-carboxy-4-(dimethylamino)butyl]-(diaminomethylidene)azanium.
| Compound Name | [(4S)-4-carboxy-4-(dimethylamino)butyl]-(diaminomethylidene)azanium |
|---|---|
| PubChem CID | 102255099 |
| Molecular Formula | C8H19N4O2+ |
| Molecular Weight | 203.27 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | [(4S)-4-carboxy-4-(dimethylamino)butyl]-(diaminomethylidene)azanium |
| SMILES | CN(C)[C@@H](CCC[NH+]=C(N)N)C(=O)O |
| InChI | InChI=1S/C8H18N4O2/c1-12(2)6(7(13)14)4-3-5-11-8(9)10/h6H,3-5H2,1-2H3,(H,13,14)(H4,9,10,11)/p+1/t6-/m0/s1 |
| InChIKey | NWGZOALPWZDXNG-LURJTMIESA-O |
| XLogP | -2.86 |
| TPSA | 106.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.27 |
| LogP ≤ 5 | -2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|