C15H24N5O3+ — CID 7009551
(2S)-2-[[(2S)-2-azaniumyl-3-phenylpropanoyl]amino]-5-(diaminomethylideneazaniumyl)pentanoate (PubChem CID 7009551) has the molecular formula C15H24N5O3+ and a molecular weight of 322.39 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-azaniumyl-3-phenylpropanoyl]amino]-5-(diaminomethylideneazaniumyl)pentanoate.
| Compound Name | (2S)-2-[[(2S)-2-azaniumyl-3-phenylpropanoyl]amino]-5-(diaminomethylideneazaniumyl)pentanoate |
|---|---|
| PubChem CID | 7009551 |
| Molecular Formula | C15H24N5O3+ |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | (2S)-2-[[(2S)-2-azaniumyl-3-phenylpropanoyl]amino]-5-(diaminomethylideneazaniumyl)pentanoate |
| SMILES | NC(N)=[NH+]CCC[C@H](NC(=O)[C@@H]([NH3+])Cc1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C15H23N5O3/c16-11(9-10-5-2-1-3-6-10)13(21)20-12(14(22)23)7-4-8-19-15(17)18/h1-3,5-6,11-12H,4,7-9,16H2,(H,20,21)(H,22,23)(H4,17,18,19)/p+1/t11-,12-/m0/s1 |
| InChIKey | OZILORBBPKKGRI-RYUDHWBXSA-O |
| XLogP | -4.79 |
| TPSA | 162.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | -4.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|