C16H23N5O5 — CID 7075269
(2S)-5-(diaminomethylideneazaniumyl)-2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]pentanoate (PubChem CID 7075269) has the molecular formula C16H23N5O5 and a molecular weight of 365.39 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneazaniumyl)-2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]pentanoate.
| Compound Name | (2S)-5-(diaminomethylideneazaniumyl)-2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]pentanoate |
|---|---|
| PubChem CID | 7075269 |
| Molecular Formula | C16H23N5O5 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | (2S)-5-(diaminomethylideneazaniumyl)-2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]pentanoate |
| SMILES | NC(N)=[NH+]CCC[C@H](NC(=O)CNC(=O)OCc1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C16H23N5O5/c17-15(18)19-8-4-7-12(14(23)24)21-13(22)9-20-16(25)26-10-11-5-2-1-3-6-11/h1-3,5-6,12H,4,7-10H2,(H,20,25)(H,21,22)(H,23,24)(H4,17,18,19)/t12-/m0/s1 |
| InChIKey | JXESLWKSHRHJFF-LBPRGKRZSA-N |
| XLogP | -3.72 |
| TPSA | 173.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | -3.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|