C18H29N6O4+ — CID 7408523
(2S)-2-[[(2S)-2-[[(2S)-2-azaniumyl-5-(diaminomethylideneazaniumyl)pentanoyl]amino]-3-phenylpropanoyl]amino]propanoate (PubChem CID 7408523) has the molecular formula C18H29N6O4+ and a molecular weight of 393.47 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2-azaniumyl-5-(diaminomethylideneazaniumyl)pentanoyl]amino]-3-phenylpropanoyl]amino]propanoate.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2-azaniumyl-5-(diaminomethylideneazaniumyl)pentanoyl]amino]-3-phenylpropanoyl]amino]propanoate |
|---|---|
| PubChem CID | 7408523 |
| Molecular Formula | C18H29N6O4+ |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-azaniumyl-5-(diaminomethylideneazaniumyl)pentanoyl]amino]-3-phenylpropanoyl]amino]propanoate |
| SMILES | C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H]([NH3+])CCC[NH+]=C(N)N)C(=O)[O-] |
| InChI | InChI=1S/C18H28N6O4/c1-11(17(27)28)23-16(26)14(10-12-6-3-2-4-7-12)24-15(25)13(19)8-5-9-22-18(20)21/h2-4,6-7,11,13-14H,5,8-10,19H2,1H3,(H,23,26)(H,24,25)(H,27,28)(H4,20,21,22)/p+1/t11-,13-,14-/m0/s1 |
| InChIKey | CZUHPNLXLWMYMG-UBHSHLNASA-O |
| XLogP | -5.29 |
| TPSA | 191.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | -5.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|