C19H31N4O5S+ — CID 7408374
(2S)-5-[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]azaniumyl-2-azaniumylpentanoate (PubChem CID 7408374) has the molecular formula C19H31N4O5S+ and a molecular weight of 427.55 g/mol. Its IUPAC name is (2S)-5-[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]azaniumyl-2-azaniumylpentanoate.
| Compound Name | (2S)-5-[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]azaniumyl-2-azaniumylpentanoate |
|---|---|
| PubChem CID | 7408374 |
| Molecular Formula | C19H31N4O5S+ |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | (2S)-5-[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]azaniumyl-2-azaniumylpentanoate |
| SMILES | Cc1c(C)c(S(=O)(=O)N/C(N)=[NH+]/CCC[C@H]([NH3+])C(=O)[O-])c(C)c2c1OC(C)(C)C2 |
| InChI | InChI=1S/C19H30N4O5S/c1-10-11(2)16(12(3)13-9-19(4,5)28-15(10)13)29(26,27)23-18(21)22-8-6-7-14(20)17(24)25/h14H,6-9,20H2,1-5H3,(H,24,25)(H3,21,22,23)/p+1/t14-/m0/s1 |
| InChIKey | GVIXTVCDNCXXSH-AWEZNQCLSA-O |
| XLogP | -2.86 |
| TPSA | 163.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | -2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|