C6H17N4O2+ — CID 21354865
5-[[amino(azaniumyl)methyl]amino]-2-azaniumylpentanoate (PubChem CID 21354865) has the molecular formula C6H17N4O2+ and a molecular weight of 177.23 g/mol. Its IUPAC name is 5-[[amino(azaniumyl)methyl]amino]-2-azaniumylpentanoate.
| Compound Name | 5-[[amino(azaniumyl)methyl]amino]-2-azaniumylpentanoate |
|---|---|
| PubChem CID | 21354865 |
| Molecular Formula | C6H17N4O2+ |
| Molecular Weight | 177.23 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 5-[[amino(azaniumyl)methyl]amino]-2-azaniumylpentanoate |
| SMILES | NC([NH3+])NCCCC([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C6H16N4O2/c7-4(5(11)12)2-1-3-10-6(8)9/h4,6,10H,1-3,7-9H2,(H,11,12)/p+1 |
| InChIKey | QAIZWPHEKDLAOM-UHFFFAOYSA-O |
| XLogP | -4.80 |
| TPSA | 133.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.23 |
| LogP ≤ 5 | -4.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|