C20H47Cl2N5O — CID 175685044
[5-[[amino(azaniumyl)methyl]amino]-1-oxo-1-(tetradecylamino)pentan-2-yl]azanium dichloride (PubChem CID 175685044) has the molecular formula C20H47Cl2N5O and a molecular weight of 444.54 g/mol. Its IUPAC name is [5-[[amino(azaniumyl)methyl]amino]-1-oxo-1-(tetradecylamino)pentan-2-yl]azanium dichloride.
| Compound Name | [5-[[amino(azaniumyl)methyl]amino]-1-oxo-1-(tetradecylamino)pentan-2-yl]azanium dichloride |
|---|---|
| PubChem CID | 175685044 |
| Molecular Formula | C20H47Cl2N5O |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 443.32 |
| IUPAC Name | [5-[[amino(azaniumyl)methyl]amino]-1-oxo-1-(tetradecylamino)pentan-2-yl]azanium dichloride |
| SMILES | CCCCCCCCCCCCCCNC(=O)C([NH3+])CCCNC(N)[NH3+].[Cl-].[Cl-] |
| InChI | InChI=1S/C20H45N5O.2ClH/c1-2-3-4-5-6-7-8-9-10-11-12-13-16-24-19(26)18(21)15-14-17-25-20(22)23;;/h18,20,25H,2-17,21-23H2,1H3,(H,24,26);2*1H |
| InChIKey | ZVWGWJSAINWCRZ-UHFFFAOYSA-N |
| XLogP | -4.72 |
| TPSA | 122.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | -4.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|