C16H31O3- — CID 129320425
(2R,3S)-2-hexyl-3-hydroxydecanoate (PubChem CID 129320425) has the molecular formula C16H31O3- and a molecular weight of 271.42 g/mol. Its IUPAC name is (2R,3S)-2-hexyl-3-hydroxydecanoate.
| Compound Name | (2R,3S)-2-hexyl-3-hydroxydecanoate |
|---|---|
| PubChem CID | 129320425 |
| Molecular Formula | C16H31O3- |
| Molecular Weight | 271.42 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | (2R,3S)-2-hexyl-3-hydroxydecanoate |
| SMILES | CCCCCCC[C@H](O)[C@@H](CCCCCC)C(=O)[O-] |
| InChI | InChI=1S/C16H32O3/c1-3-5-7-9-11-13-15(17)14(16(18)19)12-10-8-6-4-2/h14-15,17H,3-13H2,1-2H3,(H,18,19)/p-1/t14-,15+/m1/s1 |
| InChIKey | MAJPNCZLAWPPTG-CABCVRRESA-M |
| XLogP | 3.04 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|