C5H7F3NO2- — CID 152782221
(2S)-2-amino-5,5,5-trifluoropentanoate (PubChem CID 152782221) has the molecular formula C5H7F3NO2- and a molecular weight of 170.11 g/mol. Its IUPAC name is (2S)-2-amino-5,5,5-trifluoropentanoate.
| Compound Name | (2S)-2-amino-5,5,5-trifluoropentanoate |
|---|---|
| PubChem CID | 152782221 |
| Molecular Formula | C5H7F3NO2- |
| Molecular Weight | 170.11 g/mol |
| Exact Mass | 170.04 |
| IUPAC Name | (2S)-2-amino-5,5,5-trifluoropentanoate |
| SMILES | N[C@@H](CCC(F)(F)F)C(=O)[O-] |
| InChI | InChI=1S/C5H8F3NO2/c6-5(7,8)2-1-3(9)4(10)11/h3H,1-2,9H2,(H,10,11)/p-1/t3-/m0/s1 |
| InChIKey | KTZZIDWVKLDWBF-VKHMYHEASA-M |
| XLogP | -0.59 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.11 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |