C9H8Br2NO4S- — CID 2308770
(2S,3S)-2,3-dibromo-3-(4-sulfamoylphenyl)propanoate (PubChem CID 2308770) has the molecular formula C9H8Br2NO4S- and a molecular weight of 386.04 g/mol. Its IUPAC name is (2S,3S)-2,3-dibromo-3-(4-sulfamoylphenyl)propanoate.
| Compound Name | (2S,3S)-2,3-dibromo-3-(4-sulfamoylphenyl)propanoate |
|---|---|
| PubChem CID | 2308770 |
| Molecular Formula | C9H8Br2NO4S- |
| Molecular Weight | 386.04 g/mol |
| Exact Mass | 383.85 |
| IUPAC Name | (2S,3S)-2,3-dibromo-3-(4-sulfamoylphenyl)propanoate |
| SMILES | NS(=O)(=O)c1ccc([C@H](Br)[C@@H](Br)C(=O)[O-])cc1 |
| InChI | InChI=1S/C9H9Br2NO4S/c10-7(8(11)9(13)14)5-1-3-6(4-2-5)17(12,15)16/h1-4,7-8H,(H,13,14)(H2,12,15,16)/p-1/t7-,8+/m0/s1 |
| InChIKey | KUCSFQWMWYJPJA-JGVFFNPUSA-M |
| XLogP | 0.28 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.04 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|