About ethane;1-(4-sulfamoylphenyl)ethyl acetate
ethane;1-(4-sulfamoylphenyl)ethyl acetate (PubChem CID 143172857) has the molecular formula C12H19NO4S
and a molecular weight of 273.35 g/mol. Its IUPAC name is ethane;1-(4-sulfamoylphenyl)ethyl acetate.
Molecular Properties
| Compound Name | ethane;1-(4-sulfamoylphenyl)ethyl acetate |
| PubChem CID | 143172857 |
| Molecular Formula | C12H19NO4S |
| Molecular Weight | 273.35 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | ethane;1-(4-sulfamoylphenyl)ethyl acetate |
| SMILES | CC.CC(=O)OC(C)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C10H13NO4S.C2H6/c1-7(15-8(2)12)9-3-5-10(6-4-9)16(11,13)14;1-2/h3-7H,1-2H3,(H2,11,13,14);1-2H3 |
| InChIKey | CBYRLGSPXYFVMY-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.35 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;1-(4-sulfamoylphenyl)ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-(4-sulfamoylphenyl)ethyl acetate?
The IUPAC name of ethane;1-(4-sulfamoylphenyl)ethyl acetate (CID 143172857) is ethane;1-(4-sulfamoylphenyl)ethyl acetate.
What is the SMILES notation for ethane;1-(4-sulfamoylphenyl)ethyl acetate?
The canonical SMILES for ethane;1-(4-sulfamoylphenyl)ethyl acetate is CC.CC(=O)OC(C)c1ccc(S(N)(=O)=O)cc1.
What is the InChIKey of ethane;1-(4-sulfamoylphenyl)ethyl acetate?
The InChIKey is CBYRLGSPXYFVMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO4S.C2H6/c1-7(15-8(2)12)9-3-5-10(6-4-9)16(11,13)14;1-2/h3-7H,1-2H3,(H2,11,13,14);1-2H3.
What are the key properties of ethane;1-(4-sulfamoylphenyl)ethyl acetate?
ethane;1-(4-sulfamoylphenyl)ethyl acetate has a molecular weight of 273.35 g/mol, XLogP of 1.98, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-(4-sulfamoylphenyl)ethyl acetate is sourced from PubChem (CID 143172857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).