About 2-chlorobutanoic acid;ethyl acetate
2-chlorobutanoic acid;ethyl acetate (PubChem CID 161175500) has the molecular formula C8H15ClO4
and a molecular weight of 210.66 g/mol. Its IUPAC name is 2-chlorobutanoic acid;ethyl acetate.
Molecular Properties
| Compound Name | 2-chlorobutanoic acid;ethyl acetate |
| PubChem CID | 161175500 |
| Molecular Formula | C8H15ClO4 |
| Molecular Weight | 210.66 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | 2-chlorobutanoic acid;ethyl acetate |
| SMILES | CCC(Cl)C(=O)O.CCOC(C)=O |
| InChI | InChI=1S/C4H7ClO2.C4H8O2/c1-2-3(5)4(6)7;1-3-6-4(2)5/h3H,2H2,1H3,(H,6,7);3H2,1-2H3 |
| InChIKey | URTDHOFHBYBRFE-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.66 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chlorobutanoic acid;ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chlorobutanoic acid;ethyl acetate?
The IUPAC name of 2-chlorobutanoic acid;ethyl acetate (CID 161175500) is 2-chlorobutanoic acid;ethyl acetate.
What is the SMILES notation for 2-chlorobutanoic acid;ethyl acetate?
The canonical SMILES for 2-chlorobutanoic acid;ethyl acetate is CCC(Cl)C(=O)O.CCOC(C)=O.
What is the InChIKey of 2-chlorobutanoic acid;ethyl acetate?
The InChIKey is URTDHOFHBYBRFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7ClO2.C4H8O2/c1-2-3(5)4(6)7;1-3-6-4(2)5/h3H,2H2,1H3,(H,6,7);3H2,1-2H3.
What are the key properties of 2-chlorobutanoic acid;ethyl acetate?
2-chlorobutanoic acid;ethyl acetate has a molecular weight of 210.66 g/mol, XLogP of 1.66, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chlorobutanoic acid;ethyl acetate is sourced from PubChem (CID 161175500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).