About dichloromethane;ethane;ethyl acetate
dichloromethane;ethane;ethyl acetate (PubChem CID 174366150) has the molecular formula C7H16Cl2O2
and a molecular weight of 203.11 g/mol. Its IUPAC name is dichloromethane;ethane;ethyl acetate.
Molecular Properties
| Compound Name | dichloromethane;ethane;ethyl acetate |
| PubChem CID | 174366150 |
| Molecular Formula | C7H16Cl2O2 |
| Molecular Weight | 203.11 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | dichloromethane;ethane;ethyl acetate |
| SMILES | CC.CCOC(C)=O.ClCCl |
| InChI | InChI=1S/C4H8O2.C2H6.CH2Cl2/c1-3-6-4(2)5;1-2;2-1-3/h3H2,1-2H3;1-2H3;1H2 |
| InChIKey | WEHBZDLEBYRVNK-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.11 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze dichloromethane;ethane;ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloromethane;ethane;ethyl acetate?
The IUPAC name of dichloromethane;ethane;ethyl acetate (CID 174366150) is dichloromethane;ethane;ethyl acetate.
What is the SMILES notation for dichloromethane;ethane;ethyl acetate?
The canonical SMILES for dichloromethane;ethane;ethyl acetate is CC.CCOC(C)=O.ClCCl.
What is the InChIKey of dichloromethane;ethane;ethyl acetate?
The InChIKey is WEHBZDLEBYRVNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O2.C2H6.CH2Cl2/c1-3-6-4(2)5;1-2;2-1-3/h3H2,1-2H3;1-2H3;1H2.
What are the key properties of dichloromethane;ethane;ethyl acetate?
dichloromethane;ethane;ethyl acetate has a molecular weight of 203.11 g/mol, XLogP of 3.02, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dichloromethane;ethane;ethyl acetate is sourced from PubChem (CID 174366150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).