About ethane;ethyl acetate;urea
ethane;ethyl acetate;urea (PubChem CID 142544694) has the molecular formula C7H18N2O3
and a molecular weight of 178.23 g/mol. Its IUPAC name is ethane;ethyl acetate;urea.
Molecular Properties
| Compound Name | ethane;ethyl acetate;urea |
| PubChem CID | 142544694 |
| Molecular Formula | C7H18N2O3 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.13 |
| IUPAC Name | ethane;ethyl acetate;urea |
| SMILES | CC.CCOC(C)=O.NC(N)=O |
| InChI | InChI=1S/C4H8O2.C2H6.CH4N2O/c1-3-6-4(2)5;1-2;2-1(3)4/h3H2,1-2H3;1-2H3;(H4,2,3,4) |
| InChIKey | HRLZFQGVROAHNE-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;ethyl acetate;urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethyl acetate;urea?
The IUPAC name of ethane;ethyl acetate;urea (CID 142544694) is ethane;ethyl acetate;urea.
What is the SMILES notation for ethane;ethyl acetate;urea?
The canonical SMILES for ethane;ethyl acetate;urea is CC.CCOC(C)=O.NC(N)=O.
What is the InChIKey of ethane;ethyl acetate;urea?
The InChIKey is HRLZFQGVROAHNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O2.C2H6.CH4N2O/c1-3-6-4(2)5;1-2;2-1(3)4/h3H2,1-2H3;1-2H3;(H4,2,3,4).
What are the key properties of ethane;ethyl acetate;urea?
ethane;ethyl acetate;urea has a molecular weight of 178.23 g/mol, XLogP of 0.62, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethyl acetate;urea is sourced from PubChem (CID 142544694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).