C8H16O2 — CID 46215393
3,3,4,4-tetradeuterio-2-(1,1,2,2-tetradeuteriopropyl)pentanoic acid (PubChem CID 46215393) has the molecular formula C8H16O2 and a molecular weight of 152.26 g/mol. Its IUPAC name is 3,3,4,4-tetradeuterio-2-(1,1,2,2-tetradeuteriopropyl)pentanoic acid.
| Compound Name | 3,3,4,4-tetradeuterio-2-(1,1,2,2-tetradeuteriopropyl)pentanoic acid |
|---|---|
| PubChem CID | 46215393 |
| Molecular Formula | C8H16O2 |
| Molecular Weight | 152.26 g/mol |
| Exact Mass | 152.17 |
| IUPAC Name | 3,3,4,4-tetradeuterio-2-(1,1,2,2-tetradeuteriopropyl)pentanoic acid |
| SMILES | [2H]C([2H])(C)C([2H])([2H])C(C(=O)O)C([2H])([2H])C([2H])([2H])C |
| InChI | InChI=1S/C8H16O2/c1-3-5-7(6-4-2)8(9)10/h7H,3-6H2,1-2H3,(H,9,10)/i3D2,4D2,5D2,6D2 |
| InChIKey | NIJJYAXOARWZEE-SQUIKQQTSA-N |
| XLogP | 2.29 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.26 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |