C8H16O2 — CID 46832539
2,4,4-trideuterio-2-(2,2-dideuteriopropyl)pentanoic acid (PubChem CID 46832539) has the molecular formula C8H16O2 and a molecular weight of 149.24 g/mol. Its IUPAC name is 2,4,4-trideuterio-2-(2,2-dideuteriopropyl)pentanoic acid.
| Compound Name | 2,4,4-trideuterio-2-(2,2-dideuteriopropyl)pentanoic acid |
|---|---|
| PubChem CID | 46832539 |
| Molecular Formula | C8H16O2 |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.15 |
| IUPAC Name | 2,4,4-trideuterio-2-(2,2-dideuteriopropyl)pentanoic acid |
| SMILES | [2H]C([2H])(C)CC([2H])(CC([2H])([2H])C)C(=O)O |
| InChI | InChI=1S/C8H16O2/c1-3-5-7(6-4-2)8(9)10/h7H,3-6H2,1-2H3,(H,9,10)/i3D2,4D2,7D |
| InChIKey | NIJJYAXOARWZEE-VWGKVMJISA-N |
| XLogP | 2.29 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |