C9H18O — CID 87158687
3,4,4-trideuterio-3-propylhexan-2-one (PubChem CID 87158687) has the molecular formula C9H18O and a molecular weight of 145.26 g/mol. Its IUPAC name is 3,4,4-trideuterio-3-propylhexan-2-one.
| Compound Name | 3,4,4-trideuterio-3-propylhexan-2-one |
|---|---|
| PubChem CID | 87158687 |
| Molecular Formula | C9H18O |
| Molecular Weight | 145.26 g/mol |
| Exact Mass | 145.15 |
| IUPAC Name | 3,4,4-trideuterio-3-propylhexan-2-one |
| SMILES | [2H]C([2H])(CC)C([2H])(CCC)C(C)=O |
| InChI | InChI=1S/C9H18O/c1-4-6-9(7-5-2)8(3)10/h9H,4-7H2,1-3H3/i6D2,9D |
| InChIKey | RXFAGYKLLRXFDX-JGRCALCDSA-N |
| XLogP | 2.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.26 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |