About acetic acid;deuteriomethane;2-methylpentane
acetic acid;deuteriomethane;2-methylpentane (PubChem CID 158669064) has the molecular formula C9H22O2
and a molecular weight of 163.28 g/mol. Its IUPAC name is acetic acid;deuteriomethane;2-methylpentane.
Molecular Properties
| Compound Name | acetic acid;deuteriomethane;2-methylpentane |
| PubChem CID | 158669064 |
| Molecular Formula | C9H22O2 |
| Molecular Weight | 163.28 g/mol |
| Exact Mass | 163.17 |
| IUPAC Name | acetic acid;deuteriomethane;2-methylpentane |
| SMILES | CC(=O)O.CCCC(C)C.[2H]C |
| InChI | InChI=1S/C6H14.C2H4O2.CH4/c1-4-5-6(2)3;1-2(3)4;/h6H,4-5H2,1-3H3;1H3,(H,3,4);1H4/i;;1D |
| InChIKey | DEMGJWPXTMRSIE-PRQZKWGPSA-N |
| XLogP | 3.17 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.28 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze acetic acid;deuteriomethane;2-methylpentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;deuteriomethane;2-methylpentane?
The IUPAC name of acetic acid;deuteriomethane;2-methylpentane (CID 158669064) is acetic acid;deuteriomethane;2-methylpentane.
What is the SMILES notation for acetic acid;deuteriomethane;2-methylpentane?
The canonical SMILES for acetic acid;deuteriomethane;2-methylpentane is CC(=O)O.CCCC(C)C.[2H]C.
What is the InChIKey of acetic acid;deuteriomethane;2-methylpentane?
The InChIKey is DEMGJWPXTMRSIE-PRQZKWGPSA-N. The full InChI is InChI=1S/C6H14.C2H4O2.CH4/c1-4-5-6(2)3;1-2(3)4;/h6H,4-5H2,1-3H3;1H3,(H,3,4);1H4/i;;1D.
What are the key properties of acetic acid;deuteriomethane;2-methylpentane?
acetic acid;deuteriomethane;2-methylpentane has a molecular weight of 163.28 g/mol, XLogP of 3.17, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;deuteriomethane;2-methylpentane is sourced from PubChem (CID 158669064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).