About acetic acid;3-methylbutylgermane
acetic acid;3-methylbutylgermane (PubChem CID 175120417) has the molecular formula C7H18GeO2
and a molecular weight of 206.83 g/mol. Its IUPAC name is acetic acid;3-methylbutylgermane.
Molecular Properties
| Compound Name | acetic acid;3-methylbutylgermane |
| PubChem CID | 175120417 |
| Molecular Formula | C7H18GeO2 |
| Molecular Weight | 206.83 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | acetic acid;3-methylbutylgermane |
| SMILES | CC(=O)O.CC(C)CC[GeH3] |
| InChI | InChI=1S/C5H14Ge.C2H4O2/c1-5(2)3-4-6;1-2(3)4/h5H,3-4H2,1-2,6H3;1H3,(H,3,4) |
| InChIKey | SVKLFFMXBSRJHM-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.83 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze acetic acid;3-methylbutylgermane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;3-methylbutylgermane?
The IUPAC name of acetic acid;3-methylbutylgermane (CID 175120417) is acetic acid;3-methylbutylgermane.
What is the SMILES notation for acetic acid;3-methylbutylgermane?
The canonical SMILES for acetic acid;3-methylbutylgermane is CC(=O)O.CC(C)CC[GeH3].
What is the InChIKey of acetic acid;3-methylbutylgermane?
The InChIKey is SVKLFFMXBSRJHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H14Ge.C2H4O2/c1-5(2)3-4-6;1-2(3)4/h5H,3-4H2,1-2,6H3;1H3,(H,3,4).
What are the key properties of acetic acid;3-methylbutylgermane?
acetic acid;3-methylbutylgermane has a molecular weight of 206.83 g/mol, XLogP of 0.91, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;3-methylbutylgermane is sourced from PubChem (CID 175120417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).