C6H13NO2 — CID 158059410
(2S,3S,4S)-2-(15N)azanyl-3,4-dideuterio-3-(trideuterio(112C)methyl)(1,2,3-13C3)pentanoic acid (PubChem CID 158059410) has the molecular formula C6H13NO2 and a molecular weight of 140.16 g/mol. Its IUPAC name is (2S,3S,4S)-2-(15N)azanyl-3,4-dideuterio-3-(trideuterio(112C)methyl)(1,2,3-13C3)pentanoic acid.
| Compound Name | (2S,3S,4S)-2-(15N)azanyl-3,4-dideuterio-3-(trideuterio(112C)methyl)(1,2,3-13C3)pentanoic acid |
|---|---|
| PubChem CID | 158059410 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 140.16 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | (2S,3S,4S)-2-(15N)azanyl-3,4-dideuterio-3-(trideuterio(112C)methyl)(1,2,3-13C3)pentanoic acid |
| SMILES | [2H][C@@H](C)[13C@@]([2H])([13C@H]([15NH2])[13C](=O)O)[12C]([2H])([2H])[2H] |
| InChI | InChI=1S/C6H13NO2/c1-3-4(2)5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t4-,5-/m0/s1/i2+0D3,3D,4+1D,5+1,6+1,7+1/t3-,4-,5- |
| InChIKey | AGPKZVBTJJNPAG-UPDVTYBXSA-N |
| XLogP | 0.44 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.16 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |