C6H13NO2 — CID 10920571
(2S,4S)-2-amino-3,4,5,5,5-pentadeuterio-4-(113C)methylpentanoic acid (PubChem CID 10920571) has the molecular formula C6H13NO2 and a molecular weight of 137.20 g/mol. Its IUPAC name is (2S,4S)-2-amino-3,4,5,5,5-pentadeuterio-4-(113C)methylpentanoic acid.
| Compound Name | (2S,4S)-2-amino-3,4,5,5,5-pentadeuterio-4-(113C)methylpentanoic acid |
|---|---|
| PubChem CID | 10920571 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 137.20 g/mol |
| Exact Mass | 137.13 |
| IUPAC Name | (2S,4S)-2-amino-3,4,5,5,5-pentadeuterio-4-(113C)methylpentanoic acid |
| SMILES | [2H]C([C@H](N)C(=O)O)[C@]([2H])([13CH3])C([2H])([2H])[2H] |
| InChI | InChI=1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t5-/m0/s1/i1D3,2+1,3D,4D/t3?,4-,5- |
| InChIKey | ROHFNLRQFUQHCH-AGIYEAOTSA-N |
| XLogP | 0.44 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.20 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |