About (2S)-2-amino-2,3-dideuterio-3-methylpentanoic acid
(2S)-2-amino-2,3-dideuterio-3-methylpentanoic acid (PubChem CID 164674066) has the molecular formula C6H13NO2
and a molecular weight of 133.19 g/mol. Its IUPAC name is (2S)-2-amino-2,3-dideuterio-3-methylpentanoic acid.
Molecular Properties
| Compound Name | (2S)-2-amino-2,3-dideuterio-3-methylpentanoic acid |
| PubChem CID | 164674066 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.11 |
| IUPAC Name | (2S)-2-amino-2,3-dideuterio-3-methylpentanoic acid |
| SMILES | [2H]C(C)(CC)[C@]([2H])(N)C(=O)O |
| InChI | InChI=1S/C6H13NO2/c1-3-4(2)5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t4?,5-/m0/s1/i4D,5D |
| InChIKey | AGPKZVBTJJNPAG-XEUNWOMPSA-N |
| XLogP | 0.44 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-2-amino-2,3-dideuterio-3-methylpentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-2,3-dideuterio-3-methylpentanoic acid?
The IUPAC name of (2S)-2-amino-2,3-dideuterio-3-methylpentanoic acid (CID 164674066) is (2S)-2-amino-2,3-dideuterio-3-methylpentanoic acid.
What is the SMILES notation for (2S)-2-amino-2,3-dideuterio-3-methylpentanoic acid?
The canonical SMILES for (2S)-2-amino-2,3-dideuterio-3-methylpentanoic acid is [2H]C(C)(CC)[C@]([2H])(N)C(=O)O.
What is the InChIKey of (2S)-2-amino-2,3-dideuterio-3-methylpentanoic acid?
The InChIKey is AGPKZVBTJJNPAG-XEUNWOMPSA-N. The full InChI is InChI=1S/C6H13NO2/c1-3-4(2)5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t4?,5-/m0/s1/i4D,5D.
What are the key properties of (2S)-2-amino-2,3-dideuterio-3-methylpentanoic acid?
(2S)-2-amino-2,3-dideuterio-3-methylpentanoic acid has a molecular weight of 133.19 g/mol, XLogP of 0.44, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-2,3-dideuterio-3-methylpentanoic acid is sourced from PubChem (CID 164674066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).