C4H12Cl2N2O2 — CID 15941603
(2R,3S)-2,3-diaminobutanoic acid;dihydrochloride (PubChem CID 15941603) has the molecular formula C4H12Cl2N2O2 and a molecular weight of 191.06 g/mol. Its IUPAC name is (2R,3S)-2,3-diaminobutanoic acid;dihydrochloride.
| Compound Name | (2R,3S)-2,3-diaminobutanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 15941603 |
| Molecular Formula | C4H12Cl2N2O2 |
| Molecular Weight | 191.06 g/mol |
| Exact Mass | 190.03 |
| IUPAC Name | (2R,3S)-2,3-diaminobutanoic acid;dihydrochloride |
| SMILES | C[C@H](N)[C@@H](N)C(=O)O.Cl.Cl |
| InChI | InChI=1S/C4H10N2O2.2ClH/c1-2(5)3(6)4(7)8;;/h2-3H,5-6H2,1H3,(H,7,8);2*1H/t2-,3+;;/m0../s1 |
| InChIKey | DOZGWJGZHSTDJL-JSTPYPERSA-N |
| XLogP | -0.41 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.06 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |