C6H11NO5 — CID 57010806
(2S,5R)-1-amino-2,5,6-trihydroxyhexane-3,4-dione (PubChem CID 57010806) has the molecular formula C6H11NO5 and a molecular weight of 177.16 g/mol. Its IUPAC name is (2S,5R)-1-amino-2,5,6-trihydroxyhexane-3,4-dione.
| Compound Name | (2S,5R)-1-amino-2,5,6-trihydroxyhexane-3,4-dione |
|---|---|
| PubChem CID | 57010806 |
| Molecular Formula | C6H11NO5 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | (2S,5R)-1-amino-2,5,6-trihydroxyhexane-3,4-dione |
| SMILES | NC[C@H](O)C(=O)C(=O)[C@H](O)CO |
| InChI | InChI=1S/C6H11NO5/c7-1-3(9)5(11)6(12)4(10)2-8/h3-4,8-10H,1-2,7H2/t3-,4+/m0/s1 |
| InChIKey | SXDGEYSSOOJPJH-IUYQGCFVSA-N |
| XLogP | -3.20 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | -3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|