C9H17NO6 — CID 54171915
(2R,5S)-5-amino-1,2,6,7-tetrahydroxynonane-3,4-dione (PubChem CID 54171915) has the molecular formula C9H17NO6 and a molecular weight of 235.24 g/mol. Its IUPAC name is (2R,5S)-5-amino-1,2,6,7-tetrahydroxynonane-3,4-dione.
| Compound Name | (2R,5S)-5-amino-1,2,6,7-tetrahydroxynonane-3,4-dione |
|---|---|
| PubChem CID | 54171915 |
| Molecular Formula | C9H17NO6 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | (2R,5S)-5-amino-1,2,6,7-tetrahydroxynonane-3,4-dione |
| SMILES | CCC(O)C(O)[C@H](N)C(=O)C(=O)[C@H](O)CO |
| InChI | InChI=1S/C9H17NO6/c1-2-4(12)7(14)6(10)9(16)8(15)5(13)3-11/h4-7,11-14H,2-3,10H2,1H3/t4?,5-,6+,7?/m1/s1 |
| InChIKey | OVPKINULRYZGSR-LFCOQJFYSA-N |
| XLogP | -3.06 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | -3.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|