About 1-ethoxyethanesulfinate
1-ethoxyethanesulfinate (PubChem CID 174315970) has the molecular formula C4H9O3S-
and a molecular weight of 137.18 g/mol. Its IUPAC name is 1-ethoxyethanesulfinate.
Molecular Properties
| Compound Name | 1-ethoxyethanesulfinate |
| PubChem CID | 174315970 |
| Molecular Formula | C4H9O3S- |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.03 |
| IUPAC Name | 1-ethoxyethanesulfinate |
| SMILES | CCOC(C)S(=O)[O-] |
| InChI | InChI=1S/C4H10O3S/c1-3-7-4(2)8(5)6/h4H,3H2,1-2H3,(H,5,6)/p-1 |
| InChIKey | VBZZDXHHMCGGCX-UHFFFAOYSA-M |
| XLogP | 0.25 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 1-ethoxyethanesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxyethanesulfinate?
The IUPAC name of 1-ethoxyethanesulfinate (CID 174315970) is 1-ethoxyethanesulfinate.
What is the SMILES notation for 1-ethoxyethanesulfinate?
The canonical SMILES for 1-ethoxyethanesulfinate is CCOC(C)S(=O)[O-].
What is the InChIKey of 1-ethoxyethanesulfinate?
The InChIKey is VBZZDXHHMCGGCX-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H10O3S/c1-3-7-4(2)8(5)6/h4H,3H2,1-2H3,(H,5,6)/p-1.
What are the key properties of 1-ethoxyethanesulfinate?
1-ethoxyethanesulfinate has a molecular weight of 137.18 g/mol, XLogP of 0.25, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxyethanesulfinate is sourced from PubChem (CID 174315970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).