About zinc bis(butane-2-sulfinate)
zinc bis(butane-2-sulfinate) (PubChem CID 88826639) has the molecular formula C8H18O4S2Zn
and a molecular weight of 307.75 g/mol. Its IUPAC name is zinc bis(butane-2-sulfinate).
Molecular Properties
| Compound Name | zinc bis(butane-2-sulfinate) |
| PubChem CID | 88826639 |
| Molecular Formula | C8H18O4S2Zn |
| Molecular Weight | 307.75 g/mol |
| Exact Mass | 305.99 |
| IUPAC Name | zinc bis(butane-2-sulfinate) |
| SMILES | CCC(C)S(=O)[O-].CCC(C)S(=O)[O-].[Zn+2] |
| InChI | InChI=1S/2C4H10O2S.Zn/c2*1-3-4(2)7(5)6;/h2*4H,3H2,1-2H3,(H,5,6);/q;;+2/p-2 |
| InChIKey | QHQQNLYXYJLBKM-UHFFFAOYSA-L |
| XLogP | 1.33 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.75 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze zinc bis(butane-2-sulfinate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc bis(butane-2-sulfinate)?
The IUPAC name of zinc bis(butane-2-sulfinate) (CID 88826639) is zinc bis(butane-2-sulfinate).
What is the SMILES notation for zinc bis(butane-2-sulfinate)?
The canonical SMILES for zinc bis(butane-2-sulfinate) is CCC(C)S(=O)[O-].CCC(C)S(=O)[O-].[Zn+2].
What is the InChIKey of zinc bis(butane-2-sulfinate)?
The InChIKey is QHQQNLYXYJLBKM-UHFFFAOYSA-L. The full InChI is InChI=1S/2C4H10O2S.Zn/c2*1-3-4(2)7(5)6;/h2*4H,3H2,1-2H3,(H,5,6);/q;;+2/p-2.
What are the key properties of zinc bis(butane-2-sulfinate)?
zinc bis(butane-2-sulfinate) has a molecular weight of 307.75 g/mol, XLogP of 1.33, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for zinc bis(butane-2-sulfinate) is sourced from PubChem (CID 88826639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).