About 6-(chloromethyl)-4,7-dimethylnonane-2-sulfinate
6-(chloromethyl)-4,7-dimethylnonane-2-sulfinate (PubChem CID 89133296) has the molecular formula C12H24ClO2S-
and a molecular weight of 267.84 g/mol. Its IUPAC name is 6-(chloromethyl)-4,7-dimethylnonane-2-sulfinate.
Molecular Properties
| Compound Name | 6-(chloromethyl)-4,7-dimethylnonane-2-sulfinate |
| PubChem CID | 89133296 |
| Molecular Formula | C12H24ClO2S- |
| Molecular Weight | 267.84 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 6-(chloromethyl)-4,7-dimethylnonane-2-sulfinate |
| SMILES | CCC(C)C(CCl)CC(C)CC(C)S(=O)[O-] |
| InChI | InChI=1S/C12H25ClO2S/c1-5-10(3)12(8-13)7-9(2)6-11(4)16(14)15/h9-12H,5-8H2,1-4H3,(H,14,15)/p-1 |
| InChIKey | PEMSIFQTIONGCW-UHFFFAOYSA-M |
| XLogP | 3.57 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.84 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 6-(chloromethyl)-4,7-dimethylnonane-2-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(chloromethyl)-4,7-dimethylnonane-2-sulfinate?
The IUPAC name of 6-(chloromethyl)-4,7-dimethylnonane-2-sulfinate (CID 89133296) is 6-(chloromethyl)-4,7-dimethylnonane-2-sulfinate.
What is the SMILES notation for 6-(chloromethyl)-4,7-dimethylnonane-2-sulfinate?
The canonical SMILES for 6-(chloromethyl)-4,7-dimethylnonane-2-sulfinate is CCC(C)C(CCl)CC(C)CC(C)S(=O)[O-].
What is the InChIKey of 6-(chloromethyl)-4,7-dimethylnonane-2-sulfinate?
The InChIKey is PEMSIFQTIONGCW-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H25ClO2S/c1-5-10(3)12(8-13)7-9(2)6-11(4)16(14)15/h9-12H,5-8H2,1-4H3,(H,14,15)/p-1.
What are the key properties of 6-(chloromethyl)-4,7-dimethylnonane-2-sulfinate?
6-(chloromethyl)-4,7-dimethylnonane-2-sulfinate has a molecular weight of 267.84 g/mol, XLogP of 3.57, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(chloromethyl)-4,7-dimethylnonane-2-sulfinate is sourced from PubChem (CID 89133296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).