About heptane-2-sulfinate
heptane-2-sulfinate (PubChem CID 57081380) has the molecular formula C7H15O2S-
and a molecular weight of 163.26 g/mol. Its IUPAC name is heptane-2-sulfinate.
Molecular Properties
| Compound Name | heptane-2-sulfinate |
| PubChem CID | 57081380 |
| Molecular Formula | C7H15O2S- |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | heptane-2-sulfinate |
| SMILES | CCCCCC(C)S(=O)[O-] |
| InChI | InChI=1S/C7H16O2S/c1-3-4-5-6-7(2)10(8)9/h7H,3-6H2,1-2H3,(H,8,9)/p-1 |
| InChIKey | TVXXHJBUZQUIKZ-UHFFFAOYSA-M |
| XLogP | 1.83 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze heptane-2-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptane-2-sulfinate?
The IUPAC name of heptane-2-sulfinate (CID 57081380) is heptane-2-sulfinate.
What is the SMILES notation for heptane-2-sulfinate?
The canonical SMILES for heptane-2-sulfinate is CCCCCC(C)S(=O)[O-].
What is the InChIKey of heptane-2-sulfinate?
The InChIKey is TVXXHJBUZQUIKZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H16O2S/c1-3-4-5-6-7(2)10(8)9/h7H,3-6H2,1-2H3,(H,8,9)/p-1.
What are the key properties of heptane-2-sulfinate?
heptane-2-sulfinate has a molecular weight of 163.26 g/mol, XLogP of 1.83, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for heptane-2-sulfinate is sourced from PubChem (CID 57081380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).