C14H31OPS — CID 155439505
(2,3-dimethyl-3-octan-2-ylsulfinylbutan-2-yl)phosphane (PubChem CID 155439505) has the molecular formula C14H31OPS and a molecular weight of 278.44 g/mol. Its IUPAC name is (2,3-dimethyl-3-octan-2-ylsulfinylbutan-2-yl)phosphane.
| Compound Name | (2,3-dimethyl-3-octan-2-ylsulfinylbutan-2-yl)phosphane |
|---|---|
| PubChem CID | 155439505 |
| Molecular Formula | C14H31OPS |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | (2,3-dimethyl-3-octan-2-ylsulfinylbutan-2-yl)phosphane |
| SMILES | CCCCCCC(C)S(=O)C(C)(C)C(C)(C)P |
| InChI | InChI=1S/C14H31OPS/c1-7-8-9-10-11-12(2)17(15)14(5,6)13(3,4)16/h12H,7-11,16H2,1-6H3 |
| InChIKey | FUFBIZGKIUZDSU-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|