C8H16O4S2-2 — CID 174747144
2-ethylhexane-1,1-disulfinate (PubChem CID 174747144) has the molecular formula C8H16O4S2-2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 2-ethylhexane-1,1-disulfinate.
| Compound Name | 2-ethylhexane-1,1-disulfinate |
|---|---|
| PubChem CID | 174747144 |
| Molecular Formula | C8H16O4S2-2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 2-ethylhexane-1,1-disulfinate |
| SMILES | CCCCC(CC)C(S(=O)[O-])S(=O)[O-] |
| InChI | InChI=1S/C8H18O4S2/c1-3-5-6-7(4-2)8(13(9)10)14(11)12/h7-8H,3-6H2,1-2H3,(H,9,10)(H,11,12)/p-2 |
| InChIKey | XJUHNODFAGHXEK-UHFFFAOYSA-L |
| XLogP | 1.29 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|