C9H18O4S2-2 — CID 57226459
nonane-3,7-disulfinate (PubChem CID 57226459) has the molecular formula C9H18O4S2-2 and a molecular weight of 254.37 g/mol. Its IUPAC name is nonane-3,7-disulfinate.
| Compound Name | nonane-3,7-disulfinate |
|---|---|
| PubChem CID | 57226459 |
| Molecular Formula | C9H18O4S2-2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | nonane-3,7-disulfinate |
| SMILES | CCC(CCCC(CC)S(=O)[O-])S(=O)[O-] |
| InChI | InChI=1S/C9H20O4S2/c1-3-8(14(10)11)6-5-7-9(4-2)15(12)13/h8-9H,3-7H2,1-2H3,(H,10,11)(H,12,13)/p-2 |
| InChIKey | PUOWVUHJGSZGAC-UHFFFAOYSA-L |
| XLogP | 1.47 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|