About 3-methylsulfinyloctane
3-methylsulfinyloctane (PubChem CID 90756685) has the molecular formula C9H20OS
and a molecular weight of 176.32 g/mol. Its IUPAC name is 3-methylsulfinyloctane.
Molecular Properties
| Compound Name | 3-methylsulfinyloctane |
| PubChem CID | 90756685 |
| Molecular Formula | C9H20OS |
| Molecular Weight | 176.32 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 3-methylsulfinyloctane |
| SMILES | CCCCCC(CC)S(C)=O |
| InChI | InChI=1S/C9H20OS/c1-4-6-7-8-9(5-2)11(3)10/h9H,4-8H2,1-3H3 |
| InChIKey | RHQZJSWTONAFCE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-methylsulfinyloctane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylsulfinyloctane?
The IUPAC name of 3-methylsulfinyloctane (CID 90756685) is 3-methylsulfinyloctane.
What is the SMILES notation for 3-methylsulfinyloctane?
The canonical SMILES for 3-methylsulfinyloctane is CCCCCC(CC)S(C)=O.
What is the InChIKey of 3-methylsulfinyloctane?
The InChIKey is RHQZJSWTONAFCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20OS/c1-4-6-7-8-9(5-2)11(3)10/h9H,4-8H2,1-3H3.
What are the key properties of 3-methylsulfinyloctane?
3-methylsulfinyloctane has a molecular weight of 176.32 g/mol, XLogP of 2.72, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylsulfinyloctane is sourced from PubChem (CID 90756685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).