About 3-phosphorosoicosane
3-phosphorosoicosane (PubChem CID 88666329) has the molecular formula C20H41OP
and a molecular weight of 328.52 g/mol. Its IUPAC name is 3-phosphorosoicosane.
Molecular Properties
| Compound Name | 3-phosphorosoicosane |
| PubChem CID | 88666329 |
| Molecular Formula | C20H41OP |
| Molecular Weight | 328.52 g/mol |
| Exact Mass | 328.29 |
| IUPAC Name | 3-phosphorosoicosane |
| SMILES | CCCCCCCCCCCCCCCCCC(CC)P=O |
| InChI | InChI=1S/C20H41OP/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(4-2)22-21/h20H,3-19H2,1-2H3 |
| InChIKey | DCVFQFASVZPCTP-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.52 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-phosphorosoicosane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phosphorosoicosane?
The IUPAC name of 3-phosphorosoicosane (CID 88666329) is 3-phosphorosoicosane.
What is the SMILES notation for 3-phosphorosoicosane?
The canonical SMILES for 3-phosphorosoicosane is CCCCCCCCCCCCCCCCCC(CC)P=O.
What is the InChIKey of 3-phosphorosoicosane?
The InChIKey is DCVFQFASVZPCTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H41OP/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(4-2)22-21/h20H,3-19H2,1-2H3.
What are the key properties of 3-phosphorosoicosane?
3-phosphorosoicosane has a molecular weight of 328.52 g/mol, XLogP of 8.32, 18 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phosphorosoicosane is sourced from PubChem (CID 88666329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).