About decane-4-sulfinic acid
decane-4-sulfinic acid (PubChem CID 57421684) has the molecular formula C10H22O2S
and a molecular weight of 206.35 g/mol. Its IUPAC name is decane-4-sulfinic acid.
Molecular Properties
| Compound Name | decane-4-sulfinic acid |
| PubChem CID | 57421684 |
| Molecular Formula | C10H22O2S |
| Molecular Weight | 206.35 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | decane-4-sulfinic acid |
| SMILES | CCCCCCC(CCC)S(=O)O |
| InChI | InChI=1S/C10H22O2S/c1-3-5-6-7-9-10(8-4-2)13(11)12/h10H,3-9H2,1-2H3,(H,11,12) |
| InChIKey | JQKBXILLNUVUSI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.35 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze decane-4-sulfinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decane-4-sulfinic acid?
The IUPAC name of decane-4-sulfinic acid (CID 57421684) is decane-4-sulfinic acid.
What is the SMILES notation for decane-4-sulfinic acid?
The canonical SMILES for decane-4-sulfinic acid is CCCCCCC(CCC)S(=O)O.
What is the InChIKey of decane-4-sulfinic acid?
The InChIKey is JQKBXILLNUVUSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22O2S/c1-3-5-6-7-9-10(8-4-2)13(11)12/h10H,3-9H2,1-2H3,(H,11,12).
What are the key properties of decane-4-sulfinic acid?
decane-4-sulfinic acid has a molecular weight of 206.35 g/mol, XLogP of 3.35, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for decane-4-sulfinic acid is sourced from PubChem (CID 57421684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).