About methyl tridecane-6-sulfinate
methyl tridecane-6-sulfinate (PubChem CID 134426825) has the molecular formula C14H30O2S
and a molecular weight of 262.46 g/mol. Its IUPAC name is methyl tridecane-6-sulfinate.
Molecular Properties
| Compound Name | methyl tridecane-6-sulfinate |
| PubChem CID | 134426825 |
| Molecular Formula | C14H30O2S |
| Molecular Weight | 262.46 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | methyl tridecane-6-sulfinate |
| SMILES | CCCCCCCC(CCCCC)S(=O)OC |
| InChI | InChI=1S/C14H30O2S/c1-4-6-8-9-11-13-14(17(15)16-3)12-10-7-5-2/h14H,4-13H2,1-3H3 |
| InChIKey | YOUKNXDMOZJHDP-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.46 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl tridecane-6-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl tridecane-6-sulfinate?
The IUPAC name of methyl tridecane-6-sulfinate (CID 134426825) is methyl tridecane-6-sulfinate.
What is the SMILES notation for methyl tridecane-6-sulfinate?
The canonical SMILES for methyl tridecane-6-sulfinate is CCCCCCCC(CCCCC)S(=O)OC.
What is the InChIKey of methyl tridecane-6-sulfinate?
The InChIKey is YOUKNXDMOZJHDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30O2S/c1-4-6-8-9-11-13-14(17(15)16-3)12-10-7-5-2/h14H,4-13H2,1-3H3.
What are the key properties of methyl tridecane-6-sulfinate?
methyl tridecane-6-sulfinate has a molecular weight of 262.46 g/mol, XLogP of 4.61, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl tridecane-6-sulfinate is sourced from PubChem (CID 134426825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).