About hex-5-ene-3-sulfinate
hex-5-ene-3-sulfinate (PubChem CID 91536211) has the molecular formula C6H11O2S-
and a molecular weight of 147.22 g/mol. Its IUPAC name is hex-5-ene-3-sulfinate.
Molecular Properties
| Compound Name | hex-5-ene-3-sulfinate |
| PubChem CID | 91536211 |
| Molecular Formula | C6H11O2S- |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.05 |
| IUPAC Name | hex-5-ene-3-sulfinate |
| SMILES | C=CCC(CC)S(=O)[O-] |
| InChI | InChI=1S/C6H12O2S/c1-3-5-6(4-2)9(7)8/h3,6H,1,4-5H2,2H3,(H,7,8)/p-1 |
| InChIKey | CQEPSNDESPXVPD-UHFFFAOYSA-M |
| XLogP | 1.22 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze hex-5-ene-3-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hex-5-ene-3-sulfinate?
The IUPAC name of hex-5-ene-3-sulfinate (CID 91536211) is hex-5-ene-3-sulfinate.
What is the SMILES notation for hex-5-ene-3-sulfinate?
The canonical SMILES for hex-5-ene-3-sulfinate is C=CCC(CC)S(=O)[O-].
What is the InChIKey of hex-5-ene-3-sulfinate?
The InChIKey is CQEPSNDESPXVPD-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H12O2S/c1-3-5-6(4-2)9(7)8/h3,6H,1,4-5H2,2H3,(H,7,8)/p-1.
What are the key properties of hex-5-ene-3-sulfinate?
hex-5-ene-3-sulfinate has a molecular weight of 147.22 g/mol, XLogP of 1.22, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hex-5-ene-3-sulfinate is sourced from PubChem (CID 91536211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).