C11H23Cl — CID 135229642
1-chloro-2,5,6-trimethyloctane (PubChem CID 135229642) has the molecular formula C11H23Cl and a molecular weight of 190.76 g/mol. Its IUPAC name is 1-chloro-2,5,6-trimethyloctane.
| Compound Name | 1-chloro-2,5,6-trimethyloctane |
|---|---|
| PubChem CID | 135229642 |
| Molecular Formula | C11H23Cl |
| Molecular Weight | 190.76 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 1-chloro-2,5,6-trimethyloctane |
| SMILES | CCC(C)C(C)CCC(C)CCl |
| InChI | InChI=1S/C11H23Cl/c1-5-10(3)11(4)7-6-9(2)8-12/h9-11H,5-8H2,1-4H3 |
| InChIKey | GPKNTYYUVFRVQL-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.76 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|